![6-(dimethoxymethyl)-1H-pyrrolo[3,2-b]pyridine (CAS: 1015609-43-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0740385.png "6-(dimethoxymethyl)-1H-pyrrolo[3,2-b]pyridine chemical structure")
6-(dimethoxymethyl)-1H-pyrrolo[3,2-b]pyridine
Catalog No: FT-0740385
CAS No: 1015609-43-4
- Chemical Name: 6-(dimethoxymethyl)-1H-pyrrolo[3,2-b]pyridine
- Molecular Formula: C10H12N2O2
- Molecular Weight: 192.21
- InChI Key: CMPMAKMKOVYMKM-UHFFFAOYSA-N
- InChI: InChI=1S/C10H12N2O2/c1-13-10(14-2)7-5-9-8(12-6-7)3-4-11-9/h3-6,10-11H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1015609-43-4 |
|---|---|
| MF: | C10H12N2O2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 6-(Dimethoxymethyl)-1H-pyrrolo[3,2-b]pyridine |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 192.21400 |
| Exact_Mass: | 192.09000 |
|---|---|
| MF: | C10H12N2O2 |
| LogP: | 1.85430 |
| PSA: | 47.14000 |
| FW: | 192.21400 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
